CAS 1206675-01-5 appears in our catalog under these names: 2-(AMINOMETHYL)PHENOL ACETATE, 95%, 95%, 2-(Aminomethyl)phenol acetic acid salt, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
Acetic acid;2-(aminomethyl)phenol (CAS 1206675-01-5) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: acetic acid;2-(aminomethyl)phenol. InChIKey: IROPMSURBDPOOZ-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | acetic acid;2-(aminomethyl)phenol |
| InChIKey | IROPMSURBDPOOZ-UHFFFAOYSA-N |
| SMILES | CC(=O)O.C1=CC=C(C(=C1)CN)O |
Computed by PubChem (NCBI)