Products 1206724-39-1
CAS 1206724-39-1 is the registry number for Ethyl 4-(butylamino)-3-nitrobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
Ethyl 4-(butylamino)-3-nitrobenzoate (CAS 1206724-39-1) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: ethyl 4-(butylamino)-3-nitrobenzoate. InChIKey: XTYBXKDVKDHZDH-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | ethyl 4-(butylamino)-3-nitrobenzoate |
| InChIKey | XTYBXKDVKDHZDH-UHFFFAOYSA-N |
| SMILES | CCCCNC1=C(C=C(C=C1)C(=O)OCC)[N+](=O)[O-] |
Computed by PubChem (NCBI)