Products 1206969-69-8

CAS 1206969-69-8 is the registry number for Biphenyl-4-ylmethyl-piperidin-3-yl-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(4-phenylphenyl)methyl]-N-piperidin-3-ylcarbamate (CAS 1206969-69-8) is a chemical compound with the molecular formula C23H30N2O2 and a molecular weight of 366.5 g/mol. IUPAC name: tert-butyl N-[(4-phenylphenyl)methyl]-N-piperidin-3-ylcarbamate. InChIKey: UWSUXCWPSHDJRF-UHFFFAOYSA-N.

Identity
Molecular formulaC23H30N2O2
Molecular weight366.5 g/mol
IUPAC nametert-butyl N-[(4-phenylphenyl)methyl]-N-piperidin-3-ylcarbamate
InChIKeyUWSUXCWPSHDJRF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(CC1=CC=C(C=C1)C2=CC=CC=C2)C3CCCNC3

Computed by PubChem (NCBI)