Products 685530-59-0

CAS 685530-59-0 is the registry number for tert-Butyl 4-(n-benzyl-n-phenylamino) piperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(N-benzylanilino)piperidine-1-carboxylate (CAS 685530-59-0) is a chemical compound with the molecular formula C23H30N2O2 and a molecular weight of 366.5 g/mol. IUPAC name: tert-butyl 4-(N-benzylanilino)piperidine-1-carboxylate. InChIKey: HULVTHHCVMDEHS-UHFFFAOYSA-N.

Identity
Molecular formulaC23H30N2O2
Molecular weight366.5 g/mol
IUPAC nametert-butyl 4-(N-benzylanilino)piperidine-1-carboxylate
InChIKeyHULVTHHCVMDEHS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)N(CC2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)