CAS 1206970-21-9 is the registry number for 5-(2-Chloro-5-(trifluoromethyl)phenoxy)pyrazin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
5-[2-chloro-5-(trifluoromethyl)phenoxy]pyrazin-2-amine (CAS 1206970-21-9) is a chemical compound with the molecular formula C11H7ClF3N3O and a molecular weight of 289.64 g/mol. IUPAC name: 5-[2-chloro-5-(trifluoromethyl)phenoxy]pyrazin-2-amine. InChIKey: CBVBIEIAAGMIKY-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF3N3O |
|---|---|
| Molecular weight | 289.64 g/mol |
| IUPAC name | 5-[2-chloro-5-(trifluoromethyl)phenoxy]pyrazin-2-amine |
| InChIKey | CBVBIEIAAGMIKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)OC2=NC=C(N=C2)N)Cl |
Computed by PubChem (NCBI)