CAS 1346605-19-3 is the registry number for Desmethyl Norflurazon-d4. Offered by: TRC. Available pack sizes: 25mg.
5-amino-4-chloro-2-[2,3,4,6-tetradeuterio-5-(trifluoromethyl)phenyl]pyridazin-3-one (CAS 1346605-19-3) is a chemical compound with the molecular formula C11H7ClF3N3O and a molecular weight of 293.66 g/mol. IUPAC name: 5-amino-4-chloro-2-[2,3,4,6-tetradeuterio-5-(trifluoromethyl)phenyl]pyridazin-3-one. InChIKey: JIEQNXJEEHWIDV-RHQRLBAQSA-N.
| Molecular formula | C11H7ClF3N3O |
|---|---|
| Molecular weight | 293.66 g/mol |
| IUPAC name | 5-amino-4-chloro-2-[2,3,4,6-tetradeuterio-5-(trifluoromethyl)phenyl]pyridazin-3-one |
| InChIKey | JIEQNXJEEHWIDV-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])N2C(=O)C(=C(C=N2)N)Cl)[2H])C(F)(F)F)[2H] |
Computed by PubChem (NCBI)