CAS 1206970-56-0 is the registry number for 4-Amino-n-(4-(2-(4-methylpiperazin-1-yl)ethyl)phenyl)-3-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-amino-N-[4-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]-3-nitrobenzamide (CAS 1206970-56-0) is a chemical compound with the molecular formula C20H25N5O3 and a molecular weight of 383.4 g/mol. IUPAC name: 4-amino-N-[4-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]-3-nitrobenzamide. InChIKey: IZGIHEREAHLNJC-UHFFFAOYSA-N.
| Molecular formula | C20H25N5O3 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 4-amino-N-[4-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]-3-nitrobenzamide |
| InChIKey | IZGIHEREAHLNJC-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CCC2=CC=C(C=C2)NC(=O)C3=CC(=C(C=C3)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)