Products 1616391-65-1
CAS 1616391-65-1 appears in our catalog under these names: EPZ015666 (GSK3235025), EPZ-015666, EPZ015666/ 99.29% (existing batch purity), EPZ015666, EPZ015666 98%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: on request, 1mg, 25mg, 2mg, 5mg, 10mg, 50mg, 100mg.
N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-6-(oxetan-3-ylamino)pyrimidine-4-carboxamide (CAS 1616391-65-1) is a chemical compound with the molecular formula C20H25N5O3 and a molecular weight of 383.4 g/mol. IUPAC name: N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-6-(oxetan-3-ylamino)pyrimidine-4-carboxamide. InChIKey: ZKXZLIFRWWKZRY-KRWDZBQOSA-N.
| Molecular formula | C20H25N5O3 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-6-(oxetan-3-ylamino)pyrimidine-4-carboxamide |
| InChIKey | ZKXZLIFRWWKZRY-KRWDZBQOSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C[C@H](CNC(=O)C3=CC(=NC=N3)NC4COC4)O |
Computed by PubChem (NCBI)