CAS 1206970-60-6 is the registry number for N4-Ethyl-n6-(4-(methylsulfonyl)phenyl)pyrimidine-4,5,6-triamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
6-N-ethyl-4-N-(4-methylsulfonylphenyl)pyrimidine-4,5,6-triamine (CAS 1206970-60-6) is a chemical compound with the molecular formula C13H17N5O2S and a molecular weight of 307.37 g/mol. IUPAC name: 6-N-ethyl-4-N-(4-methylsulfonylphenyl)pyrimidine-4,5,6-triamine. InChIKey: BKXFPIVSQXDZDE-UHFFFAOYSA-N.
| Molecular formula | C13H17N5O2S |
|---|---|
| Molecular weight | 307.37 g/mol |
| IUPAC name | 6-N-ethyl-4-N-(4-methylsulfonylphenyl)pyrimidine-4,5,6-triamine |
| InChIKey | BKXFPIVSQXDZDE-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C(=NC=N1)NC2=CC=C(C=C2)S(=O)(=O)C)N |
Computed by PubChem (NCBI)