CAS 202466-77-1 is the registry number for Ro 63-0563. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-amino-N-[2,6-bis(methylamino)-4-pyridinyl]benzenesulfonamide (CAS 202466-77-1) is a chemical compound with the molecular formula C13H17N5O2S and a molecular weight of 307.37 g/mol. IUPAC name: 4-amino-N-[2,6-bis(methylamino)-4-pyridinyl]benzenesulfonamide. InChIKey: PTFNKZLSFWJYFJ-UHFFFAOYSA-N.
| Molecular formula | C13H17N5O2S |
|---|---|
| Molecular weight | 307.37 g/mol |
| IUPAC name | 4-amino-N-[2,6-bis(methylamino)-4-pyridinyl]benzenesulfonamide |
| InChIKey | PTFNKZLSFWJYFJ-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=CC(=N1)NC)NS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)