CAS 1207-15-4 appears in our catalog under these names: 2,8-Dimethyldibenzothiophene, 97%, 2,8-Dimethyldibenzothiophene, 2,8–Dimethyldibenzothiophene, 2,8-Dimethyldibenzothiophene, >97.0%(GC), 2,8-Dimethyldibenzo[b,d]thiophene, 97%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 100mg, 2,5g, 250mg, 10mg, 50mg.
2,8-dimethyldibenzothiophene (CAS 1207-15-4) is a chemical compound with the molecular formula C14H12S and a molecular weight of 212.31 g/mol. IUPAC name: 2,8-dimethyldibenzothiophene. InChIKey: RRYWCJRYULRSJM-UHFFFAOYSA-N.
| Molecular formula | C14H12S |
|---|---|
| Molecular weight | 212.31 g/mol |
| IUPAC name | 2,8-dimethyldibenzothiophene |
| InChIKey | RRYWCJRYULRSJM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)SC3=C2C=C(C=C3)C |
Computed by PubChem (NCBI)