CAS 89816-99-9 is the registry number for 4-Ethyldibenzothiophene. Offered by: TRC. Available pack sizes: 1g.
4-ethyldibenzothiophene (CAS 89816-99-9) is a chemical compound with the molecular formula C14H12S and a molecular weight of 212.31 g/mol. IUPAC name: 4-ethyldibenzothiophene. InChIKey: BQANWUIWGKINGF-UHFFFAOYSA-N.
| Molecular formula | C14H12S |
|---|---|
| Molecular weight | 212.31 g/mol |
| IUPAC name | 4-ethyldibenzothiophene |
| InChIKey | BQANWUIWGKINGF-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C3=CC=CC=C3S2 |
Computed by PubChem (NCBI)