CAS 120713-58-8 appears in our catalog under these names: 5-Hydroxy-1,3,3-trimethylindolin-2-one, 97%, 5–Hydroxy–1，3，3–trimethyl–1，3–dihydro–indol–2–one, 5-Hydroxy-1,3,3-trimethylindolin-2-one. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
5-hydroxy-1,3,3-trimethylindol-2-one (CAS 120713-58-8) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 5-hydroxy-1,3,3-trimethylindol-2-one. InChIKey: JHAJGKDFHKWIMV-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 5-hydroxy-1,3,3-trimethylindol-2-one |
| InChIKey | JHAJGKDFHKWIMV-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)O)N(C1=O)C)C |
Computed by PubChem (NCBI)