CAS 120738-89-8 is the registry number for Nitenpyram(mixture of E/Z-isomers). Offered by: Chemat Brand. Available pack sizes: on request.
1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine (CAS 120738-89-8) is a chemical compound with the molecular formula C11H15ClN4O2 and a molecular weight of 270.71 g/mol. IUPAC name: 1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine. InChIKey: CFRPSFYHXJZSBI-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN4O2 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine |
| InChIKey | CFRPSFYHXJZSBI-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CN=C(C=C1)Cl)C(=C[N+](=O)[O-])NC |
Computed by PubChem (NCBI)