Products 848369-62-0
CAS 848369-62-0 is the registry number for 3-Butyl-8-(chloromethyl)-7-methyl-3,7-dihydro-1h-purine-2,6-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-butyl-8-(chloromethyl)-7-methylpurine-2,6-dione (CAS 848369-62-0) is a chemical compound with the molecular formula C11H15ClN4O2 and a molecular weight of 270.71 g/mol. IUPAC name: 3-butyl-8-(chloromethyl)-7-methylpurine-2,6-dione. InChIKey: IDGLEPAAILVMAZ-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN4O2 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 3-butyl-8-(chloromethyl)-7-methylpurine-2,6-dione |
| InChIKey | IDGLEPAAILVMAZ-UHFFFAOYSA-N |
| SMILES | CCCCN1C2=C(C(=O)NC1=O)N(C(=N2)CCl)C |
Computed by PubChem (NCBI)