CAS 1207448-50-7 is the registry number for 4-Bromo-5-fluoro-1,2-dihydroisoquinolin-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-5-fluoro-2H-isoquinolin-1-one (CAS 1207448-50-7) is a chemical compound with the molecular formula C9H5BrFNO and a molecular weight of 242.04 g/mol. IUPAC name: 4-bromo-5-fluoro-2H-isoquinolin-1-one. InChIKey: JCBIPKKIGJQGCM-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2H-isoquinolin-1-one |
| InChIKey | JCBIPKKIGJQGCM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=CNC2=O)Br |
Computed by PubChem (NCBI)