Products 2080367-38-8

CAS 2080367-38-8 is the registry number for 4-Benzyl 1-(tert-butyl) (2S,6R)-2,6-dimethylpiperazine-1,4-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-O-benzyl 1-O-tert-butyl (2R,6S)-2,6-dimethylpiperazine-1,4-dicarboxylate (CAS 2080367-38-8) is a chemical compound with the molecular formula C19H28N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: 4-O-benzyl 1-O-tert-butyl (2R,6S)-2,6-dimethylpiperazine-1,4-dicarboxylate. InChIKey: BQDWTKGOXJXCIY-GASCZTMLSA-N.

Identity
Molecular formulaC19H28N2O4
Molecular weight348.4 g/mol
IUPAC name4-O-benzyl 1-O-tert-butyl (2R,6S)-2,6-dimethylpiperazine-1,4-dicarboxylate
InChIKeyBQDWTKGOXJXCIY-GASCZTMLSA-N
SMILESC[C@@H]1CN(C[C@@H](N1C(=O)OC(C)(C)C)C)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)