CAS 1207557-47-8 appears in our catalog under these names: Methyl 4-bromo-5-(difluoromethyl)thiophene-2-carboxylate, 95%, Methyl 4–bromo–5–(difluoromethyl)thiophene–2–carboxylate, Methyl 4-bromo-5-(difluoromethyl)thiophene-2-carboxylate. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
Methyl 4-bromo-5-(difluoromethyl)thiophene-2-carboxylate (CAS 1207557-47-8) is a chemical compound with the molecular formula C7H5BrF2O2S and a molecular weight of 271.08 g/mol. IUPAC name: methyl 4-bromo-5-(difluoromethyl)thiophene-2-carboxylate. InChIKey: SYAUEMYKGPPNQA-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF2O2S |
|---|---|
| Molecular weight | 271.08 g/mol |
| IUPAC name | methyl 4-bromo-5-(difluoromethyl)thiophene-2-carboxylate |
| InChIKey | SYAUEMYKGPPNQA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(S1)C(F)F)Br |
Computed by PubChem (NCBI)