CAS 1240528-68-0 appears in our catalog under these names: (4-Bromo-2-fluorophenyl)methanesulfonyl fluoride, 95%, (4-Bromo-2-fluorophenyl)methanesulfonyl fluoride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
(4-bromo-2-fluorophenyl)methanesulfonyl fluoride (CAS 1240528-68-0) is a chemical compound with the molecular formula C7H5BrF2O2S and a molecular weight of 271.08 g/mol. IUPAC name: (4-bromo-2-fluorophenyl)methanesulfonyl fluoride. InChIKey: BOYHGJVWBKVNRT-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF2O2S |
|---|---|
| Molecular weight | 271.08 g/mol |
| IUPAC name | (4-bromo-2-fluorophenyl)methanesulfonyl fluoride |
| InChIKey | BOYHGJVWBKVNRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)CS(=O)(=O)F |
Computed by PubChem (NCBI)