CAS 1207627-28-8 is the registry number for 6-Bromo-5-chloro-1H-imidazo(4,5-b)pyridin-2(3H)-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-5-chloro-1,3-dihydroimidazo[4,5-b]pyridin-2-one (CAS 1207627-28-8) is a chemical compound with the molecular formula C6H3BrClN3O and a molecular weight of 248.46 g/mol. IUPAC name: 6-bromo-5-chloro-1,3-dihydroimidazo[4,5-b]pyridin-2-one. InChIKey: QBEIIRMZUFQZSJ-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3O |
|---|---|
| Molecular weight | 248.46 g/mol |
| IUPAC name | 6-bromo-5-chloro-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| InChIKey | QBEIIRMZUFQZSJ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1Br)Cl)NC(=O)N2 |
Computed by PubChem (NCBI)