CAS 1703794-44-8 is the registry number for 6-bromo-5-chloro-3H,4H-pyrrolo[2,1-f][1,2,4]triazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-5-chloro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (CAS 1703794-44-8) is a chemical compound with the molecular formula C6H3BrClN3O and a molecular weight of 248.46 g/mol. IUPAC name: 6-bromo-5-chloro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one. InChIKey: FZDQOUDQRSLSFO-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3O |
|---|---|
| Molecular weight | 248.46 g/mol |
| IUPAC name | 6-bromo-5-chloro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| InChIKey | FZDQOUDQRSLSFO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C2N1N=CNC2=O)Cl)Br |
Computed by PubChem (NCBI)