Products 1207726-86-0

CAS 1207726-86-0 is the registry number for 3-(Benzoylmethylamino)-2-fluorobenzoic acid, 98%+(LC-MS),RG, 98%+(LC-MS),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-fluoro-3-(phenacylamino)benzoic acid (CAS 1207726-86-0) is a chemical compound with the molecular formula C15H12FNO3 and a molecular weight of 273.26 g/mol. IUPAC name: 2-fluoro-3-(phenacylamino)benzoic acid. InChIKey: YQIHNEWWIFUYJX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12FNO3
Molecular weight273.26 g/mol
IUPAC name2-fluoro-3-(phenacylamino)benzoic acid
InChIKeyYQIHNEWWIFUYJX-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)CNC2=CC=CC(=C2F)C(=O)O

Computed by PubChem (NCBI)