CAS 926269-36-5 is the registry number for 2-(2-Fluorobenzamido)-3-methylbenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[(2-fluorobenzoyl)amino]-3-methylbenzoic acid (CAS 926269-36-5) is a chemical compound with the molecular formula C15H12FNO3 and a molecular weight of 273.26 g/mol. IUPAC name: 2-[(2-fluorobenzoyl)amino]-3-methylbenzoic acid. InChIKey: YAFXYJRVSLHDDU-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO3 |
|---|---|
| Molecular weight | 273.26 g/mol |
| IUPAC name | 2-[(2-fluorobenzoyl)amino]-3-methylbenzoic acid |
| InChIKey | YAFXYJRVSLHDDU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)O)NC(=O)C2=CC=CC=C2F |
Computed by PubChem (NCBI)