CAS 1207754-85-5 appears in our catalog under these names: 2-(P-Tolylsulfonyl)-6-oxa-2-azaspiro[2.5]octane, 95%, 2–(p–Tolylsulfonyl)–6–oxa–2–azaspiro(2·5)octane. Offered by: Combi-blocks, GLPBio. Available pack sizes: 500mg, 250mg.
1-(4-methylphenyl)sulfonyl-6-oxa-1-azaspiro[2.5]octane (CAS 1207754-85-5) is a chemical compound with the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-6-oxa-1-azaspiro[2.5]octane. InChIKey: OSRAUQFHLRKEPJ-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3S |
|---|---|
| Molecular weight | 267.35 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-6-oxa-1-azaspiro[2.5]octane |
| InChIKey | OSRAUQFHLRKEPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC23CCOCC3 |
Computed by PubChem (NCBI)