CAS 129415-92-5 is the registry number for 3,3-Dimethyl-4-[(4-methylbenzenesulfonyl)oxy]butanenitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3-cyano-2,2-dimethylpropyl) 4-methylbenzenesulfonate (CAS 129415-92-5) is a chemical compound with the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. IUPAC name: (3-cyano-2,2-dimethylpropyl) 4-methylbenzenesulfonate. InChIKey: XICPDHQLAOBFMC-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3S |
|---|---|
| Molecular weight | 267.35 g/mol |
| IUPAC name | (3-cyano-2,2-dimethylpropyl) 4-methylbenzenesulfonate |
| InChIKey | XICPDHQLAOBFMC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C)(C)CC#N |
Computed by PubChem (NCBI)