Products 1207853-10-8
CAS 1207853-10-8 is the registry number for Cis-4-fluoro-3-hydroxy-piperidine-1-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 250mg.
Benzyl (3S,4R)-4-fluoro-3-hydroxypiperidine-1-carboxylate (CAS 1207853-10-8) is a chemical compound with the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. IUPAC name: benzyl (3S,4R)-4-fluoro-3-hydroxypiperidine-1-carboxylate. InChIKey: HNBFJUNWIWJEJJ-NEPJUHHUSA-N.
| Molecular formula | C13H16FNO3 |
|---|---|
| Molecular weight | 253.27 g/mol |
| IUPAC name | benzyl (3S,4R)-4-fluoro-3-hydroxypiperidine-1-carboxylate |
| InChIKey | HNBFJUNWIWJEJJ-NEPJUHHUSA-N |
| SMILES | C1CN(C[C@@H]([C@@H]1F)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)