CAS 1372096-37-1 is the registry number for 5-(N-Boc-aminomethyl)-2-formylfluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.
Tert-butyl N-[(3-fluoro-4-formylphenyl)methyl]carbamate (CAS 1372096-37-1) is a chemical compound with the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. IUPAC name: tert-butyl N-[(3-fluoro-4-formylphenyl)methyl]carbamate. InChIKey: BXEXCMXXYGSEJZ-UHFFFAOYSA-N.
| Molecular formula | C13H16FNO3 |
|---|---|
| Molecular weight | 253.27 g/mol |
| IUPAC name | tert-butyl N-[(3-fluoro-4-formylphenyl)methyl]carbamate |
| InChIKey | BXEXCMXXYGSEJZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC(=C(C=C1)C=O)F |
Computed by PubChem (NCBI)