CAS 1207955-00-7 is the registry number for 2,3,5,6-Tetrafluorophenyl 6-fluoronicotinate, >95%, >95%. Offered by: Chemat. Available pack sizes: 5g.
(2,3,5,6-tetrafluorophenyl) 6-fluoropyridine-3-carboxylate (CAS 1207955-00-7) is a chemical compound with the molecular formula C12H4F5NO2 and a molecular weight of 289.16 g/mol. IUPAC name: (2,3,5,6-tetrafluorophenyl) 6-fluoropyridine-3-carboxylate. InChIKey: PXMBERVGUSOWLQ-UHFFFAOYSA-N.
| Molecular formula | C12H4F5NO2 |
|---|---|
| Molecular weight | 289.16 g/mol |
| IUPAC name | (2,3,5,6-tetrafluorophenyl) 6-fluoropyridine-3-carboxylate |
| InChIKey | PXMBERVGUSOWLQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)OC2=C(C(=CC(=C2F)F)F)F)F |
Computed by PubChem (NCBI)