CAS 1208078-28-7 is the registry number for 2'-Methoxy-2,2,2,6'-tetrafluoroacetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,2,2-trifluoro-1-(2-fluoro-6-methoxyphenyl)ethanone (CAS 1208078-28-7) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2-fluoro-6-methoxyphenyl)ethanone. InChIKey: NAOAQKZCJCAVPM-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2-fluoro-6-methoxyphenyl)ethanone |
| InChIKey | NAOAQKZCJCAVPM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)