CAS 1208078-32-3 is the registry number for 4-Amino-7-fluoro-3,4-dihydrocinnoline-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-7-fluoro-3,4-dihydrocinnoline-3-carboxylic acid (CAS 1208078-32-3) is a chemical compound with the molecular formula C9H8FN3O2 and a molecular weight of 209.18 g/mol. IUPAC name: 4-amino-7-fluoro-3,4-dihydrocinnoline-3-carboxylic acid. InChIKey: MBQRLUBIASCYEQ-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3O2 |
|---|---|
| Molecular weight | 209.18 g/mol |
| IUPAC name | 4-amino-7-fluoro-3,4-dihydrocinnoline-3-carboxylic acid |
| InChIKey | MBQRLUBIASCYEQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)N=NC(C2N)C(=O)O |
Computed by PubChem (NCBI)