CAS 3062250-90-9 is the registry number for 1-(6-Fluoropyridin-3-yl)dihydropyrimidine-2,4(1H,3H)-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(6-fluoro-3-pyridinyl)-1,3-diazinane-2,4-dione (CAS 3062250-90-9) is a chemical compound with the molecular formula C9H8FN3O2 and a molecular weight of 209.18 g/mol. IUPAC name: 1-(6-fluoro-3-pyridinyl)-1,3-diazinane-2,4-dione. InChIKey: SVWGGNBTKPOGEI-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3O2 |
|---|---|
| Molecular weight | 209.18 g/mol |
| IUPAC name | 1-(6-fluoro-3-pyridinyl)-1,3-diazinane-2,4-dione |
| InChIKey | SVWGGNBTKPOGEI-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CN=C(C=C2)F |
Computed by PubChem (NCBI)