CAS 1208313-97-6 appears in our catalog under these names: (R,R)-BD-AcAc 2, 98%, BD-AcAc 2/ 99.62% (existing batch purity), Ketone Ester, BD-AcAc 2, (3R)-3-Hydroxybutyl (3R)-3-hydroxybutanoate, 99.62% ,, 99.62% ,. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5mg, 10mg, 50mg, 100mg, 25mg, 500mg.
[(3R)-3-hydroxybutyl] (3R)-3-hydroxybutanoate (CAS 1208313-97-6) is a chemical compound with the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. IUPAC name: [(3R)-3-hydroxybutyl] (3R)-3-hydroxybutanoate. InChIKey: AOWPVIWVMWUSBD-RNFRBKRXSA-N.
| Molecular formula | C8H16O4 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | [(3R)-3-hydroxybutyl] (3R)-3-hydroxybutanoate |
| InChIKey | AOWPVIWVMWUSBD-RNFRBKRXSA-N |
| SMILES | C[C@H](CCOC(=O)C[C@@H](C)O)O |
Computed by PubChem (NCBI)