CAS 1208402-13-4 appears in our catalog under these names: 6–Chloro–3–phenyl–1–benzofuran–2–carboxylic acid, 6-Chloro-3-phenyl-1-benzofuran-2-carboxylic acid, 6-Chloro-3-phenyl-1-benzofuran-2-carboxylic acid 95%. Offered by: GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g.
6-chloro-3-phenyl-1-benzofuran-2-carboxylic acid (CAS 1208402-13-4) is a chemical compound with the molecular formula C15H9ClO3 and a molecular weight of 272.68 g/mol. IUPAC name: 6-chloro-3-phenyl-1-benzofuran-2-carboxylic acid. InChIKey: PJKPYMBVXIXFSZ-UHFFFAOYSA-N.
| Molecular formula | C15H9ClO3 |
|---|---|
| Molecular weight | 272.68 g/mol |
| IUPAC name | 6-chloro-3-phenyl-1-benzofuran-2-carboxylic acid |
| InChIKey | PJKPYMBVXIXFSZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC3=C2C=CC(=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)