CAS 26965-47-9 is the registry number for 5-Chloro-3-phenylbenzofuran-2-carboxylic acid 97%. Offered by: Ambeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
5-chloro-3-phenyl-1-benzofuran-2-carboxylic acid (CAS 26965-47-9) is a chemical compound with the molecular formula C15H9ClO3 and a molecular weight of 272.68 g/mol. IUPAC name: 5-chloro-3-phenyl-1-benzofuran-2-carboxylic acid. InChIKey: URKXSHCRWIOSAN-UHFFFAOYSA-N.
| Molecular formula | C15H9ClO3 |
|---|---|
| Molecular weight | 272.68 g/mol |
| IUPAC name | 5-chloro-3-phenyl-1-benzofuran-2-carboxylic acid |
| InChIKey | URKXSHCRWIOSAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC3=C2C=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)