CAS 1208797-35-6 appears in our catalog under these names: 2,2,2-Trifluoroethyl N-(1,3-benzothiazol-2-yl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(1,3-benzothiazol-2-yl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2,2,2-trifluoroethyl N-(1,3-benzothiazol-2-yl)carbamate (CAS 1208797-35-6) is a chemical compound with the molecular formula C10H7F3N2O2S and a molecular weight of 276.24 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(1,3-benzothiazol-2-yl)carbamate. InChIKey: PQTVLABBSSEIMV-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2O2S |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(1,3-benzothiazol-2-yl)carbamate |
| InChIKey | PQTVLABBSSEIMV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)