CAS 175202-29-6 appears in our catalog under these names: 5-(1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl)thiophene-2-carboxylic acid, 95+%, 2-[1-Methyl-3-(trifluoromethyl)pyrazol-5-yl]-thiophene-5-carboxylic acid. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 250mg.
5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophene-2-carboxylic acid (CAS 175202-29-6) is a chemical compound with the molecular formula C10H7F3N2O2S and a molecular weight of 276.24 g/mol. IUPAC name: 5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophene-2-carboxylic acid. InChIKey: CQGIJDSTTJYEES-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2O2S |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | 5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophene-2-carboxylic acid |
| InChIKey | CQGIJDSTTJYEES-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C2=CC=C(S2)C(=O)O |
Computed by PubChem (NCBI)