CAS 1209382-96-6 appears in our catalog under these names: 2-(3-Bromo-5-methoxy-4-(2,2,2-trifluoroethoxy)phenyl)acetonitrile, 95%, 2-(3-Bromo-5-methoxy-4-(2,2,2-trifluoroethoxy)phenyl)acetonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-[3-bromo-5-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]acetonitrile (CAS 1209382-96-6) is a chemical compound with the molecular formula C11H9BrF3NO2 and a molecular weight of 324.09 g/mol. IUPAC name: 2-[3-bromo-5-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]acetonitrile. InChIKey: FBNNPSXXGMJSPM-UHFFFAOYSA-N.
| Molecular formula | C11H9BrF3NO2 |
|---|---|
| Molecular weight | 324.09 g/mol |
| IUPAC name | 2-[3-bromo-5-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]acetonitrile |
| InChIKey | FBNNPSXXGMJSPM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)CC#N)Br)OCC(F)(F)F |
Computed by PubChem (NCBI)