Products 2939002-83-0
CAS 2939002-83-0 is the registry number for 1-(2-Bromo-5-(trifluoromethoxy)phenyl)pyrrolidin-2-one, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-[2-bromo-5-(trifluoromethoxy)phenyl]pyrrolidin-2-one (CAS 2939002-83-0) is a chemical compound with the molecular formula C11H9BrF3NO2 and a molecular weight of 324.09 g/mol. IUPAC name: 1-[2-bromo-5-(trifluoromethoxy)phenyl]pyrrolidin-2-one. InChIKey: ZJZFMNPHXMDMFW-UHFFFAOYSA-N.
| Molecular formula | C11H9BrF3NO2 |
|---|---|
| Molecular weight | 324.09 g/mol |
| IUPAC name | 1-[2-bromo-5-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
| InChIKey | ZJZFMNPHXMDMFW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=C(C=CC(=C2)OC(F)(F)F)Br |
Computed by PubChem (NCBI)