CAS 120940-43-4 is the registry number for N-Methyl-n-[2-nitro-4-(trifluoromethyl)phenyl]hydrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-methyl-1-[2-nitro-4-(trifluoromethyl)phenyl]hydrazine (CAS 120940-43-4) is a chemical compound with the molecular formula C8H8F3N3O2 and a molecular weight of 235.16 g/mol. IUPAC name: 1-methyl-1-[2-nitro-4-(trifluoromethyl)phenyl]hydrazine. InChIKey: GBBAZCATUSUQOJ-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N3O2 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | 1-methyl-1-[2-nitro-4-(trifluoromethyl)phenyl]hydrazine |
| InChIKey | GBBAZCATUSUQOJ-UHFFFAOYSA-N |
| SMILES | CN(C1=C(C=C(C=C1)C(F)(F)F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)