CAS 1535990-71-6 is the registry number for 3-(Trifluoromethyl)-5H,6H,7H,8H-imidazo(1,5-a)pyrazine-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylic acid (CAS 1535990-71-6) is a chemical compound with the molecular formula C8H8F3N3O2 and a molecular weight of 235.16 g/mol. IUPAC name: 3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylic acid. InChIKey: CIHGWAYXHJUTMP-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N3O2 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | 3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylic acid |
| InChIKey | CIHGWAYXHJUTMP-UHFFFAOYSA-N |
| SMILES | C1CN2C(=C(N=C2C(F)(F)F)C(=O)O)CN1 |
Computed by PubChem (NCBI)