Products 1209458-89-8
CAS 1209458-89-8 appears in our catalog under these names: 6-Bromo-N,N-dimethylpyrazine-2-carboxamide, 98%, 6-Bromo-N,N-dimethylpyrazine-2-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g, 50mg.
6-bromo-N,N-dimethylpyrazine-2-carboxamide (CAS 1209458-89-8) is a chemical compound with the molecular formula C7H8BrN3O and a molecular weight of 230.06 g/mol. IUPAC name: 6-bromo-N,N-dimethylpyrazine-2-carboxamide. InChIKey: DHSGQVQRVNAPRF-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 6-bromo-N,N-dimethylpyrazine-2-carboxamide |
| InChIKey | DHSGQVQRVNAPRF-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CN=CC(=N1)Br |
Computed by PubChem (NCBI)