Products 1209536-64-0
CAS 1209536-64-0 is the registry number for (2-Amino-2-(3,4-dimethoxyphenyl)ethyl)dimethylamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3,4-dimethoxyphenyl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride (CAS 1209536-64-0) is a chemical compound with the molecular formula C12H22Cl2N2O2 and a molecular weight of 297.22 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride. InChIKey: SKZQGQZOENLQHW-UHFFFAOYSA-N.
| Molecular formula | C12H22Cl2N2O2 |
|---|---|
| Molecular weight | 297.22 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride |
| InChIKey | SKZQGQZOENLQHW-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C1=CC(=C(C=C1)OC)OC)N.Cl.Cl |
Computed by PubChem (NCBI)