Products 133464-04-7
CAS 133464-04-7 is the registry number for (2S,7S)-1,8-Dichloro-2,7-diisopropyl-3,6-diazaoctane-4,5-dione, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N,N'-bis[(2S)-1-chloro-3-methylbutan-2-yl]oxamide (CAS 133464-04-7) is a chemical compound with the molecular formula C12H22Cl2N2O2 and a molecular weight of 297.22 g/mol. IUPAC name: N,N'-bis[(2S)-1-chloro-3-methylbutan-2-yl]oxamide. InChIKey: SMZRKIYJYFISTE-NXEZZACHSA-N.
| Molecular formula | C12H22Cl2N2O2 |
|---|---|
| Molecular weight | 297.22 g/mol |
| IUPAC name | N,N'-bis[(2S)-1-chloro-3-methylbutan-2-yl]oxamide |
| InChIKey | SMZRKIYJYFISTE-NXEZZACHSA-N |
| SMILES | CC(C)[C@@H](CCl)NC(=O)C(=O)N[C@H](CCl)C(C)C |
Computed by PubChem (NCBI)