CAS 1209722-71-3 is the registry number for [(5-Phenyl-1,3,4-oxadiazol-2-yl)methyl]amine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Oxalic acid;(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine (CAS 1209722-71-3) is a chemical compound with the molecular formula C11H11N3O5 and a molecular weight of 265.22 g/mol. IUPAC name: oxalic acid;(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine. InChIKey: HQLMHJUPFRSIJO-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O5 |
|---|---|
| Molecular weight | 265.22 g/mol |
| IUPAC name | oxalic acid;(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine |
| InChIKey | HQLMHJUPFRSIJO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)