Products 1209722-71-3

CAS 1209722-71-3 is the registry number for [(5-Phenyl-1,3,4-oxadiazol-2-yl)methyl]amine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Oxalic acid;(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine (CAS 1209722-71-3) is a chemical compound with the molecular formula C11H11N3O5 and a molecular weight of 265.22 g/mol. IUPAC name: oxalic acid;(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine. InChIKey: HQLMHJUPFRSIJO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11N3O5
Molecular weight265.22 g/mol
IUPAC nameoxalic acid;(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine
InChIKeyHQLMHJUPFRSIJO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NN=C(O2)CN.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)