CAS 380580-59-6 is the registry number for 5-[(3,5-Dimethyl-4-nitro-1h-pyrazol-1-yl)methyl]-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-carboxylic acid (CAS 380580-59-6) is a chemical compound with the molecular formula C11H11N3O5 and a molecular weight of 265.22 g/mol. IUPAC name: 5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-carboxylic acid. InChIKey: WWNBPKPNFYJWDG-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O5 |
|---|---|
| Molecular weight | 265.22 g/mol |
| IUPAC name | 5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-carboxylic acid |
| InChIKey | WWNBPKPNFYJWDG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC=C(O2)C(=O)O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)