Products 380580-59-6

CAS 380580-59-6 is the registry number for 5-[(3,5-Dimethyl-4-nitro-1h-pyrazol-1-yl)methyl]-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-carboxylic acid (CAS 380580-59-6) is a chemical compound with the molecular formula C11H11N3O5 and a molecular weight of 265.22 g/mol. IUPAC name: 5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-carboxylic acid. InChIKey: WWNBPKPNFYJWDG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11N3O5
Molecular weight265.22 g/mol
IUPAC name5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-carboxylic acid
InChIKeyWWNBPKPNFYJWDG-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1CC2=CC=C(O2)C(=O)O)C)[N+](=O)[O-]

Computed by PubChem (NCBI)