CAS 1209736-28-6 is the registry number for Sodium (1,2,4)triazolo(1,5-a)pyrimidine-7-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium [1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate (CAS 1209736-28-6) is a chemical compound with the molecular formula C6H3N4NaO2 and a molecular weight of 186.10 g/mol. IUPAC name: sodium [1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate. InChIKey: FNNFZIZGMJEDEU-UHFFFAOYSA-M.
| Molecular formula | C6H3N4NaO2 |
|---|---|
| Molecular weight | 186.10 g/mol |
| IUPAC name | sodium [1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate |
| InChIKey | FNNFZIZGMJEDEU-UHFFFAOYSA-M |
| SMILES | C1=C(N2C(=NC=N2)N=C1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)