CAS 2377031-62-2 is the registry number for Sodium 6-formyl-(1,2,4)triazolo(1,5-a)pyrimidin-7-olate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Sodium 6-formyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate (CAS 2377031-62-2) is a chemical compound with the molecular formula C6H3N4NaO2 and a molecular weight of 186.10 g/mol. IUPAC name: sodium 6-formyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate. InChIKey: FAKPNSZAMUGDAG-UHFFFAOYSA-M.
| Molecular formula | C6H3N4NaO2 |
|---|---|
| Molecular weight | 186.10 g/mol |
| IUPAC name | sodium 6-formyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate |
| InChIKey | FAKPNSZAMUGDAG-UHFFFAOYSA-M |
| SMILES | C1=NC2=NC=NN2C(=C1C=O)[O-].[Na+] |
Computed by PubChem (NCBI)