CAS 1209906-44-4 appears in our catalog under these names: N-(4-Bromobenzyl)-t-butylamine hydrochloride, 95%, N-(4-Bromobenzyl)-2-methylpropan-2-amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
N-[(4-bromophenyl)methyl]-2-methylpropan-2-amine;hydrochloride (CAS 1209906-44-4) is a chemical compound with the molecular formula C11H17BrClN and a molecular weight of 278.61 g/mol. IUPAC name: N-[(4-bromophenyl)methyl]-2-methylpropan-2-amine;hydrochloride. InChIKey: ZTCVFIGUTHIZMA-UHFFFAOYSA-N.
| Molecular formula | C11H17BrClN |
|---|---|
| Molecular weight | 278.61 g/mol |
| IUPAC name | N-[(4-bromophenyl)methyl]-2-methylpropan-2-amine;hydrochloride |
| InChIKey | ZTCVFIGUTHIZMA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC1=CC=C(C=C1)Br.Cl |
Computed by PubChem (NCBI)