CAS 2411591-67-6 appears in our catalog under these names: (1S)-1-(4-Bromophenyl)-2,2-dimethylpropylamine hydrochloride, 95%, (S)–1–(4–Bromophenyl)–2,2–dimethylpropan–1–amine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
(1S)-1-(4-bromophenyl)-2,2-dimethylpropan-1-amine;hydrochloride (CAS 2411591-67-6) is a chemical compound with the molecular formula C11H17BrClN and a molecular weight of 278.61 g/mol. IUPAC name: (1S)-1-(4-bromophenyl)-2,2-dimethylpropan-1-amine;hydrochloride. InChIKey: UTUSZWMMKUEXIR-HNCPQSOCSA-N.
| Molecular formula | C11H17BrClN |
|---|---|
| Molecular weight | 278.61 g/mol |
| IUPAC name | (1S)-1-(4-bromophenyl)-2,2-dimethylpropan-1-amine;hydrochloride |
| InChIKey | UTUSZWMMKUEXIR-HNCPQSOCSA-N |
| SMILES | CC(C)(C)[C@@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)