Products 1209947-02-3
CAS 1209947-02-3 appears in our catalog under these names: 1-(2,5-difluorophenyl)cyclopropan-1-amine, ≥95%, [1-(2,5-difluorophenyl)cyclopropyl]amine hydrochloride, 99%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 50mg, 500mg.
1-(2,5-difluorophenyl)cyclopropan-1-amine (CAS 1209947-02-3) is a chemical compound with the molecular formula C9H9F2N and a molecular weight of 169.17 g/mol. IUPAC name: 1-(2,5-difluorophenyl)cyclopropan-1-amine. InChIKey: XFKFEVCSHCTSQX-UHFFFAOYSA-N.
| Molecular formula | C9H9F2N |
|---|---|
| Molecular weight | 169.17 g/mol |
| IUPAC name | 1-(2,5-difluorophenyl)cyclopropan-1-amine |
| InChIKey | XFKFEVCSHCTSQX-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=CC(=C2)F)F)N |
Computed by PubChem (NCBI)